About methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate
methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate (PubChem CID 25335529) has the molecular formula C16H13ClN2O4S2
and a molecular weight of 396.88 g/mol. Its IUPAC name is methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate |
| PubChem CID | 25335529 |
| Molecular Formula | C16H13ClN2O4S2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(S(=O)(=O)Nc2nc3c(C)cccc3s2)c1 |
| InChI | InChI=1S/C16H13ClN2O4S2/c1-9-4-3-5-12-14(9)18-16(24-12)19-25(21,22)13-8-10(15(20)23-2)6-7-11(13)17/h3-8H,1-2H3,(H,18,19) |
| InChIKey | SJAQDHOMYYQFIB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate?
The IUPAC name of methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate (CID 25335529) is methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate.
What is the SMILES notation for methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate?
The canonical SMILES for methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate is COC(=O)c1ccc(Cl)c(S(=O)(=O)Nc2nc3c(C)cccc3s2)c1.
What is the InChIKey of methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate?
The InChIKey is SJAQDHOMYYQFIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClN2O4S2/c1-9-4-3-5-12-14(9)18-16(24-12)19-25(21,22)13-8-10(15(20)23-2)6-7-11(13)17/h3-8H,1-2H3,(H,18,19).
What are the key properties of methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate?
methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate has a molecular weight of 396.88 g/mol, XLogP of 3.85, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-3-[(4-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoate is sourced from PubChem (CID 25335529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).