C13H23N3O4 — CID 25338249
1-ethyl-3-[(1S,2S,3S,4R,5R)-3-hydroxy-4-pyrrolidin-1-yl-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea (PubChem CID 25338249) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-ethyl-3-[(1S,2S,3S,4R,5R)-3-hydroxy-4-pyrrolidin-1-yl-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea.
| Compound Name | 1-ethyl-3-[(1S,2S,3S,4R,5R)-3-hydroxy-4-pyrrolidin-1-yl-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea |
|---|---|
| PubChem CID | 25338249 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-ethyl-3-[(1S,2S,3S,4R,5R)-3-hydroxy-4-pyrrolidin-1-yl-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea |
| SMILES | CCNC(=O)N[C@H]1[C@H](O)[C@@H](N2CCCC2)[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C13H23N3O4/c1-2-14-13(18)15-9-8-7-19-12(20-8)10(11(9)17)16-5-3-4-6-16/h8-12,17H,2-7H2,1H3,(H2,14,15,18)/t8-,9-,10-,11+,12-/m1/s1 |
| InChIKey | WTFOAAIGGKFCHH-PZWNZHSQSA-N |
| XLogP | -0.75 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |