C19H27F3N4O2 — CID 25351035
4-(diethylamino)-N'-[2-[(3R)-3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide (PubChem CID 25351035) has the molecular formula C19H27F3N4O2 and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-(diethylamino)-N'-[2-[(3R)-3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide.
| Compound Name | 4-(diethylamino)-N'-[2-[(3R)-3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 25351035 |
| Molecular Formula | C19H27F3N4O2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 4-(diethylamino)-N'-[2-[(3R)-3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)CN2CCC[C@@H](C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C19H27F3N4O2/c1-3-26(4-2)16-9-7-14(8-10-16)18(28)24-23-17(27)13-25-11-5-6-15(12-25)19(20,21)22/h7-10,15H,3-6,11-13H2,1-2H3,(H,23,27)(H,24,28)/t15-/m1/s1 |
| InChIKey | JGOIQUKNVGZYDJ-OAHLLOKOSA-N |
| XLogP | 2.57 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|