C24H34N2OS2 — CID 25382686
(1'R,5'S)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]spiro[1,3-dithiolane-2,8'-bicyclo[3.2.1]octane]-3'-carboxamide (PubChem CID 25382686) has the molecular formula C24H34N2OS2 and a molecular weight of 430.68 g/mol. Its IUPAC name is (1'R,5'S)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]spiro[1,3-dithiolane-2,8'-bicyclo[3.2.1]octane]-3'-carboxamide.
| Compound Name | (1'R,5'S)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]spiro[1,3-dithiolane-2,8'-bicyclo[3.2.1]octane]-3'-carboxamide |
|---|---|
| PubChem CID | 25382686 |
| Molecular Formula | C24H34N2OS2 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (1'R,5'S)-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]spiro[1,3-dithiolane-2,8'-bicyclo[3.2.1]octane]-3'-carboxamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)C1C[C@H]2CC[C@@H](C1)C21SCCS1 |
| InChI | InChI=1S/C24H34N2OS2/c1-25(17-18-5-9-22(10-6-18)26-11-3-2-4-12-26)23(27)19-15-20-7-8-21(16-19)24(20)28-13-14-29-24/h5-6,9-10,19-21H,2-4,7-8,11-17H2,1H3/t19?,20-,21+ |
| InChIKey | IQWRNSKEGRNRHZ-SEJPIABJSA-N |
| XLogP | 5.25 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|