C17H32N2O2+2 — CID 2541834
3-[[(2S)-2-hydroxy-3-(2,3,6-trimethylphenoxy)propyl]azaniumyl]propyl-dimethylazanium (PubChem CID 2541834) has the molecular formula C17H32N2O2+2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 3-[[(2S)-2-hydroxy-3-(2,3,6-trimethylphenoxy)propyl]azaniumyl]propyl-dimethylazanium.
| Compound Name | 3-[[(2S)-2-hydroxy-3-(2,3,6-trimethylphenoxy)propyl]azaniumyl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 2541834 |
| Molecular Formula | C17H32N2O2+2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 3-[[(2S)-2-hydroxy-3-(2,3,6-trimethylphenoxy)propyl]azaniumyl]propyl-dimethylazanium |
| SMILES | Cc1ccc(C)c(OC[C@@H](O)C[NH2+]CCC[NH+](C)C)c1C |
| InChI | InChI=1S/C17H30N2O2/c1-13-7-8-14(2)17(15(13)3)21-12-16(20)11-18-9-6-10-19(4)5/h7-8,16,18,20H,6,9-12H2,1-5H3/p+2/t16-/m0/s1 |
| InChIKey | MTZURZQNFVIBHJ-INIZCTEOSA-P |
| XLogP | -0.55 |
| TPSA | 50.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|