C28H35N3OS2 — CID 2544566
2-[[5-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2,4,5-trimethylphenyl)ethanone (PubChem CID 2544566) has the molecular formula C28H35N3OS2 and a molecular weight of 493.74 g/mol. Its IUPAC name is 2-[[5-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2,4,5-trimethylphenyl)ethanone.
| Compound Name | 2-[[5-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2,4,5-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 2544566 |
| Molecular Formula | C28H35N3OS2 |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 2-[[5-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2,4,5-trimethylphenyl)ethanone |
| SMILES | C=CCn1c(SCC(=O)c2cc(C)c(C)cc2C)nnc1-c1cc2c(s1)CC[C@@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C28H35N3OS2/c1-8-11-31-26(25-15-20-14-21(28(5,6)7)9-10-24(20)34-25)29-30-27(31)33-16-23(32)22-13-18(3)17(2)12-19(22)4/h8,12-13,15,21H,1,9-11,14,16H2,2-7H3/t21-/m1/s1 |
| InChIKey | PMDZCYGOXLQCRN-OAQYLSRUSA-N |
| XLogP | 7.24 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|