C21H31N5O2S2 — CID 41288514
(2S)-2-[[5-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-carbamoyl-3-methylbutanamide (PubChem CID 41288514) has the molecular formula C21H31N5O2S2 and a molecular weight of 449.65 g/mol. Its IUPAC name is (2S)-2-[[5-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-carbamoyl-3-methylbutanamide.
| Compound Name | (2S)-2-[[5-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-carbamoyl-3-methylbutanamide |
|---|---|
| PubChem CID | 41288514 |
| Molecular Formula | C21H31N5O2S2 |
| Molecular Weight | 449.65 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (2S)-2-[[5-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-carbamoyl-3-methylbutanamide |
| SMILES | CC(C)[C@H](Sc1nnc(-c2cc3c(s2)CC[C@@H](C(C)(C)C)C3)n1C)C(=O)NC(N)=O |
| InChI | InChI=1S/C21H31N5O2S2/c1-11(2)16(18(27)23-19(22)28)30-20-25-24-17(26(20)6)15-10-12-9-13(21(3,4)5)7-8-14(12)29-15/h10-11,13,16H,7-9H2,1-6H3,(H3,22,23,27,28)/t13-,16+/m1/s1 |
| InChIKey | KRVPXFOWONDPLQ-CJNGLKHVSA-N |
| XLogP | 4.01 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |