C17H23N5O2S2 — CID 7793239
(2S)-N-carbamoyl-2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 7793239) has the molecular formula C17H23N5O2S2 and a molecular weight of 393.54 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-carbamoyl-2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 7793239 |
| Molecular Formula | C17H23N5O2S2 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (2S)-N-carbamoyl-2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | CC[C@H]1CCc2sc(-c3nnc(S[C@@H](C)C(=O)NC(N)=O)n3C)cc2C1 |
| InChI | InChI=1S/C17H23N5O2S2/c1-4-10-5-6-12-11(7-10)8-13(26-12)14-20-21-17(22(14)3)25-9(2)15(23)19-16(18)24/h8-10H,4-7H2,1-3H3,(H3,18,19,23,24)/t9-,10-/m0/s1 |
| InChIKey | CPFQKYRAJROQHS-UWVGGRQHSA-N |
| XLogP | 2.73 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |