C19H22N4OS2 — CID 41134213
2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(1H-pyrrol-2-yl)ethanone (PubChem CID 41134213) has the molecular formula C19H22N4OS2 and a molecular weight of 386.55 g/mol. Its IUPAC name is 2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(1H-pyrrol-2-yl)ethanone.
| Compound Name | 2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(1H-pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 41134213 |
| Molecular Formula | C19H22N4OS2 |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-(1H-pyrrol-2-yl)ethanone |
| SMILES | CC[C@H]1CCc2sc(-c3nnc(SCC(=O)c4ccc[nH]4)n3C)cc2C1 |
| InChI | InChI=1S/C19H22N4OS2/c1-3-12-6-7-16-13(9-12)10-17(26-16)18-21-22-19(23(18)2)25-11-15(24)14-5-4-8-20-14/h4-5,8,10,12,20H,3,6-7,9,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | HORCKBUUGGCEAP-LBPRGKRZSA-N |
| XLogP | 4.36 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |