C18H22N4S3 — CID 112777557
4-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-methyl-1,3-thiazole (PubChem CID 112777557) has the molecular formula C18H22N4S3 and a molecular weight of 390.60 g/mol. Its IUPAC name is 4-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 112777557 |
| Molecular Formula | C18H22N4S3 |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 4-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-methyl-1,3-thiazole |
| SMILES | CCC1CCc2sc(-c3nnc(SCc4csc(C)n4)n3C)cc2C1 |
| InChI | InChI=1S/C18H22N4S3/c1-4-12-5-6-15-13(7-12)8-16(25-15)17-20-21-18(22(17)3)24-10-14-9-23-11(2)19-14/h8-9,12H,4-7,10H2,1-3H3 |
| InChIKey | VDYLIJKLCCNSGN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |