C18H22N4OS2 — CID 46672595
5-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-3-methyl-1,2-oxazole (PubChem CID 46672595) has the molecular formula C18H22N4OS2 and a molecular weight of 374.54 g/mol. Its IUPAC name is 5-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 46672595 |
| Molecular Formula | C18H22N4OS2 |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 5-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-3-methyl-1,2-oxazole |
| SMILES | CCC1CCc2sc(-c3nnc(SCc4cc(C)no4)n3C)cc2C1 |
| InChI | InChI=1S/C18H22N4OS2/c1-4-12-5-6-15-13(8-12)9-16(25-15)17-19-20-18(22(17)3)24-10-14-7-11(2)21-23-14/h7,9,12H,4-6,8,10H2,1-3H3 |
| InChIKey | IYWOPQACGQKOAE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |