C20H28N4O3S3 — CID 40972059
2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 40972059) has the molecular formula C20H28N4O3S3 and a molecular weight of 468.67 g/mol. Its IUPAC name is 2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 40972059 |
| Molecular Formula | C20H28N4O3S3 |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CC[C@H]1CCc2sc(-c3nnc(SCC(=O)N[C@]4(C)CCS(=O)(=O)C4)n3C)cc2C1 |
| InChI | InChI=1S/C20H28N4O3S3/c1-4-13-5-6-15-14(9-13)10-16(29-15)18-22-23-19(24(18)3)28-11-17(25)21-20(2)7-8-30(26,27)12-20/h10,13H,4-9,11-12H2,1-3H3,(H,21,25)/t13-,20+/m0/s1 |
| InChIKey | UPSIOHOPMNGOOC-RNODOKPDSA-N |
| XLogP | 2.84 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |