C23H25N5OS3 — CID 42980837
N-[2-(cyanomethylsulfanyl)phenyl]-2-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 42980837) has the molecular formula C23H25N5OS3 and a molecular weight of 483.69 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 42980837 |
| Molecular Formula | C23H25N5OS3 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCC1CCc2sc(-c3nnc(SCC(=O)Nc4ccccc4SCC#N)n3C)cc2C1 |
| InChI | InChI=1S/C23H25N5OS3/c1-3-15-8-9-18-16(12-15)13-20(32-18)22-26-27-23(28(22)2)31-14-21(29)25-17-6-4-5-7-19(17)30-11-10-24/h4-7,13,15H,3,8-9,11-12,14H2,1-2H3,(H,25,29) |
| InChIKey | NFARKORZZIEIPZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |