C19H23N5OS2 — CID 7625663
(2S)-2-ethanimidoyl-4-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile (PubChem CID 7625663) has the molecular formula C19H23N5OS2 and a molecular weight of 401.56 g/mol. Its IUPAC name is (2S)-2-ethanimidoyl-4-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile.
| Compound Name | (2S)-2-ethanimidoyl-4-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 7625663 |
| Molecular Formula | C19H23N5OS2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (2S)-2-ethanimidoyl-4-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanenitrile |
| SMILES | [H]/N=C(\C)[C@@H](C#N)C(=O)CSc1nnc(-c2cc3c(s2)CC[C@H](CC)C3)n1C |
| InChI | InChI=1S/C19H23N5OS2/c1-4-12-5-6-16-13(7-12)8-17(27-16)18-22-23-19(24(18)3)26-10-15(25)14(9-20)11(2)21/h8,12,14,21H,4-7,10H2,1-3H3/b21-11+/t12-,14+/m0/s1 |
| InChIKey | QATGJJYNZIVRQD-UWUAPECKSA-N |
| XLogP | 3.90 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|