C18H23N5OS2 — CID 7793203
N-(2-cyanoethyl)-2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 7793203) has the molecular formula C18H23N5OS2 and a molecular weight of 389.55 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7793203 |
| Molecular Formula | C18H23N5OS2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | N-(2-cyanoethyl)-2-[[5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC[C@H]1CCc2sc(-c3nnc(SCC(=O)NCCC#N)n3C)cc2C1 |
| InChI | InChI=1S/C18H23N5OS2/c1-3-12-5-6-14-13(9-12)10-15(26-14)17-21-22-18(23(17)2)25-11-16(24)20-8-4-7-19/h10,12H,3-6,8-9,11H2,1-2H3,(H,20,24)/t12-/m0/s1 |
| InChIKey | HKIDCWZYFQHTQH-LBPRGKRZSA-N |
| XLogP | 3.18 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|