C21H32N4O2S2 — CID 51713277
2-[[5-[(5S)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)acetamide (PubChem CID 51713277) has the molecular formula C21H32N4O2S2 and a molecular weight of 436.65 g/mol. Its IUPAC name is 2-[[5-[(5S)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[[5-[(5S)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 51713277 |
| Molecular Formula | C21H32N4O2S2 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-[[5-[(5S)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nnc(-c2cc3c(s2)CC[C@H](C(C)(C)C)C3)n1C |
| InChI | InChI=1S/C21H32N4O2S2/c1-21(2,3)15-7-8-16-14(11-15)12-17(29-16)19-23-24-20(25(19)4)28-13-18(26)22-9-6-10-27-5/h12,15H,6-11,13H2,1-5H3,(H,22,26)/t15-/m0/s1 |
| InChIKey | XMUBEBCODJZMNZ-HNNXBMFYSA-N |
| XLogP | 3.94 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|