C20H30N4OS2 — CID 7793222
2-[[5-[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-pentan-3-ylacetamide (PubChem CID 7793222) has the molecular formula C20H30N4OS2 and a molecular weight of 406.62 g/mol. Its IUPAC name is 2-[[5-[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-pentan-3-ylacetamide.
| Compound Name | 2-[[5-[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 7793222 |
| Molecular Formula | C20H30N4OS2 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[[5-[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CSc1nnc(-c2cc3c(s2)CC[C@@H](CC)C3)n1C |
| InChI | InChI=1S/C20H30N4OS2/c1-5-13-8-9-16-14(10-13)11-17(27-16)19-22-23-20(24(19)4)26-12-18(25)21-15(6-2)7-3/h11,13,15H,5-10,12H2,1-4H3,(H,21,25)/t13-/m1/s1 |
| InChIKey | WDNDYXVCLMLEIV-CYBMUJFWSA-N |
| XLogP | 4.46 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |