C19H26N4OS2 — CID 8957685
(2S)-2-[[5-[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylpropanamide (PubChem CID 8957685) has the molecular formula C19H26N4OS2 and a molecular weight of 390.58 g/mol. Its IUPAC name is (2S)-2-[[5-[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylpropanamide.
| Compound Name | (2S)-2-[[5-[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 8957685 |
| Molecular Formula | C19H26N4OS2 |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (2S)-2-[[5-[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@H](C)Sc1nnc(-c2cc3c(s2)CC[C@@H](CC)C3)n1C |
| InChI | InChI=1S/C19H26N4OS2/c1-5-9-20-18(24)12(3)25-19-22-21-17(23(19)4)16-11-14-10-13(6-2)7-8-15(14)26-16/h5,11-13H,1,6-10H2,2-4H3,(H,20,24)/t12-,13+/m0/s1 |
| InChIKey | WOOLYVHTSOQHLB-QWHCGFSZSA-N |
| XLogP | 3.84 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|