C21H23Cl2N3S3 — CID 2532883
3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazole (PubChem CID 2532883) has the molecular formula C21H23Cl2N3S3 and a molecular weight of 484.54 g/mol. Its IUPAC name is 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 2532883 |
| Molecular Formula | C21H23Cl2N3S3 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 3-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-5-[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazole |
| SMILES | CC[C@H]1CCc2sc(-c3nnc(SCCSc4cc(Cl)ccc4Cl)n3C)cc2C1 |
| InChI | InChI=1S/C21H23Cl2N3S3/c1-3-13-4-7-17-14(10-13)11-19(29-17)20-24-25-21(26(20)2)28-9-8-27-18-12-15(22)5-6-16(18)23/h5-6,11-13H,3-4,7-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | SGKHQCSUPJGMDX-ZDUSSCGKSA-N |
| XLogP | 7.25 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|