C20H30N4OS2 — CID 51642399
(2R)-2-[[5-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-ethylpropanamide (PubChem CID 51642399) has the molecular formula C20H30N4OS2 and a molecular weight of 406.62 g/mol. Its IUPAC name is (2R)-2-[[5-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-ethylpropanamide.
| Compound Name | (2R)-2-[[5-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 51642399 |
| Molecular Formula | C20H30N4OS2 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (2R)-2-[[5-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-ethylpropanamide |
| SMILES | CCNC(=O)[C@@H](C)Sc1nnc(-c2cc3c(s2)CC[C@@H](C(C)(C)C)C3)n1C |
| InChI | InChI=1S/C20H30N4OS2/c1-7-21-18(25)12(2)26-19-23-22-17(24(19)6)16-11-13-10-14(20(3,4)5)8-9-15(13)27-16/h11-12,14H,7-10H2,1-6H3,(H,21,25)/t12-,14-/m1/s1 |
| InChIKey | VNVZHTQVVUFZCD-TZMCWYRMSA-N |
| XLogP | 4.31 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |