C18H25N5O2S2 — CID 7793236
(2R)-2-[[5-[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(methylcarbamoyl)propanamide (PubChem CID 7793236) has the molecular formula C18H25N5O2S2 and a molecular weight of 407.57 g/mol. Its IUPAC name is (2R)-2-[[5-[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(methylcarbamoyl)propanamide.
| Compound Name | (2R)-2-[[5-[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 7793236 |
| Molecular Formula | C18H25N5O2S2 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (2R)-2-[[5-[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(methylcarbamoyl)propanamide |
| SMILES | CC[C@@H]1CCc2sc(-c3nnc(S[C@H](C)C(=O)NC(=O)NC)n3C)cc2C1 |
| InChI | InChI=1S/C18H25N5O2S2/c1-5-11-6-7-13-12(8-11)9-14(27-13)15-21-22-18(23(15)4)26-10(2)16(24)20-17(25)19-3/h9-11H,5-8H2,1-4H3,(H2,19,20,24,25)/t10-,11-/m1/s1 |
| InChIKey | ICSJXMAQWUWOGY-GHMZBOCLSA-N |
| XLogP | 2.99 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |