C22H26N3O2+ — CID 2558654
4-cyano-N-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ium-1-ylethyl]benzamide (PubChem CID 2558654) has the molecular formula C22H26N3O2+ and a molecular weight of 364.47 g/mol. Its IUPAC name is 4-cyano-N-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ium-1-ylethyl]benzamide.
| Compound Name | 4-cyano-N-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ium-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 2558654 |
| Molecular Formula | C22H26N3O2+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 4-cyano-N-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ium-1-ylethyl]benzamide |
| SMILES | COc1ccc([C@@H](CNC(=O)c2ccc(C#N)cc2)[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-27-20-11-9-18(10-12-20)21(25-13-3-2-4-14-25)16-24-22(26)19-7-5-17(15-23)6-8-19/h5-12,21H,2-4,13-14,16H2,1H3,(H,24,26)/p+1/t21-/m1/s1 |
| InChIKey | OEPJTIFGJLKJRQ-OAQYLSRUSA-O |
| XLogP | 2.11 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |