About tetrazolo[1,5-a]quinoline-4-carbonitrile
tetrazolo[1,5-a]quinoline-4-carbonitrile (PubChem CID 2565899) has the molecular formula C10H5N5
and a molecular weight of 195.19 g/mol. Its IUPAC name is tetrazolo[1,5-a]quinoline-4-carbonitrile.
Molecular Properties
| Compound Name | tetrazolo[1,5-a]quinoline-4-carbonitrile |
| PubChem CID | 2565899 |
| Molecular Formula | C10H5N5 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | tetrazolo[1,5-a]quinoline-4-carbonitrile |
| SMILES | N#Cc1cc2ccccc2n2nnnc12 |
| InChI | InChI=1S/C10H5N5/c11-6-8-5-7-3-1-2-4-9(7)15-10(8)12-13-14-15/h1-5H |
| InChIKey | UMVLKYWMWGIFNN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 66.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tetrazolo[1,5-a]quinoline-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrazolo[1,5-a]quinoline-4-carbonitrile?
The IUPAC name of tetrazolo[1,5-a]quinoline-4-carbonitrile (CID 2565899) is tetrazolo[1,5-a]quinoline-4-carbonitrile.
What is the SMILES notation for tetrazolo[1,5-a]quinoline-4-carbonitrile?
The canonical SMILES for tetrazolo[1,5-a]quinoline-4-carbonitrile is N#Cc1cc2ccccc2n2nnnc12.
What is the InChIKey of tetrazolo[1,5-a]quinoline-4-carbonitrile?
The InChIKey is UMVLKYWMWGIFNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5N5/c11-6-8-5-7-3-1-2-4-9(7)15-10(8)12-13-14-15/h1-5H.
What are the key properties of tetrazolo[1,5-a]quinoline-4-carbonitrile?
tetrazolo[1,5-a]quinoline-4-carbonitrile has a molecular weight of 195.19 g/mol, XLogP of 1.15, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tetrazolo[1,5-a]quinoline-4-carbonitrile is sourced from PubChem (CID 2565899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).