C25H26FN5O5 — CID 26008484
(4R)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-7-fluoro-N-(3-methoxypropyl)-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 26008484) has the molecular formula C25H26FN5O5 and a molecular weight of 495.51 g/mol. Its IUPAC name is (4R)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-7-fluoro-N-(3-methoxypropyl)-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | (4R)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-7-fluoro-N-(3-methoxypropyl)-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 26008484 |
| Molecular Formula | C25H26FN5O5 |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | (4R)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-7-fluoro-N-(3-methoxypropyl)-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | COCCCN(C(=O)[C@@H]1CC(=O)Nc2cc(F)ccc21)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H26FN5O5/c1-36-11-5-10-30(24(34)18-13-20(32)28-19-12-16(26)8-9-17(18)19)21-22(27)31(25(35)29-23(21)33)14-15-6-3-2-4-7-15/h2-4,6-9,12,18H,5,10-11,13-14,27H2,1H3,(H,28,32)(H,29,33,35)/t18-/m1/s1 |
| InChIKey | IORQUKGTNNGFKP-GOSISDBHSA-N |
| XLogP | 1.80 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|