C13H16N2OS2 — CID 26087870
4-ethyl-5-propyl-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide (PubChem CID 26087870) has the molecular formula C13H16N2OS2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 4-ethyl-5-propyl-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | 4-ethyl-5-propyl-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26087870 |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-ethyl-5-propyl-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide |
| SMILES | CCCc1sc(C(=O)Nc2nccs2)cc1CC |
| InChI | InChI=1S/C13H16N2OS2/c1-3-5-10-9(4-2)8-11(18-10)12(16)15-13-14-6-7-17-13/h6-8H,3-5H2,1-2H3,(H,14,15,16) |
| InChIKey | AUGPGDHUWKVDBA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |