C25H26F2N4O4S — CID 26136849
N-(2-acetamidoethyl)-3-[(2,4-difluorophenyl)methylamino]-5-[(2-methylphenyl)sulfamoyl]benzamide (PubChem CID 26136849) has the molecular formula C25H26F2N4O4S and a molecular weight of 516.57 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-3-[(2,4-difluorophenyl)methylamino]-5-[(2-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(2-acetamidoethyl)-3-[(2,4-difluorophenyl)methylamino]-5-[(2-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 26136849 |
| Molecular Formula | C25H26F2N4O4S |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | N-(2-acetamidoethyl)-3-[(2,4-difluorophenyl)methylamino]-5-[(2-methylphenyl)sulfamoyl]benzamide |
| SMILES | CC(=O)NCCNC(=O)c1cc(NCc2ccc(F)cc2F)cc(S(=O)(=O)Nc2ccccc2C)c1 |
| InChI | InChI=1S/C25H26F2N4O4S/c1-16-5-3-4-6-24(16)31-36(34,35)22-12-19(25(33)29-10-9-28-17(2)32)11-21(14-22)30-15-18-7-8-20(26)13-23(18)27/h3-8,11-14,30-31H,9-10,15H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | QPCVVYSOZSRJDS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|