C24H19N5O2 — CID 26182684
(7R)-2-methyl-5-(3-nitrophenyl)-3-phenyl-7-pyridin-4-yl-6,7-dihydropyrazolo[1,5-a]pyrimidine (PubChem CID 26182684) has the molecular formula C24H19N5O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is (7R)-2-methyl-5-(3-nitrophenyl)-3-phenyl-7-pyridin-4-yl-6,7-dihydropyrazolo[1,5-a]pyrimidine.
| Compound Name | (7R)-2-methyl-5-(3-nitrophenyl)-3-phenyl-7-pyridin-4-yl-6,7-dihydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 26182684 |
| Molecular Formula | C24H19N5O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (7R)-2-methyl-5-(3-nitrophenyl)-3-phenyl-7-pyridin-4-yl-6,7-dihydropyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1nn2c(c1-c1ccccc1)N=C(c1cccc([N+](=O)[O-])c1)C[C@@H]2c1ccncc1 |
| InChI | InChI=1S/C24H19N5O2/c1-16-23(18-6-3-2-4-7-18)24-26-21(19-8-5-9-20(14-19)29(30)31)15-22(28(24)27-16)17-10-12-25-13-11-17/h2-14,22H,15H2,1H3/t22-/m1/s1 |
| InChIKey | ZLEYACAJVKKWLU-JOCHJYFZSA-N |
| XLogP | 5.28 |
| TPSA | 86.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|