C25H21N5O3 — CID 26182717
(7S)-3-(4-methoxyphenyl)-2-methyl-5-(3-nitrophenyl)-7-pyridin-3-yl-6,7-dihydropyrazolo[1,5-a]pyrimidine (PubChem CID 26182717) has the molecular formula C25H21N5O3 and a molecular weight of 439.48 g/mol. Its IUPAC name is (7S)-3-(4-methoxyphenyl)-2-methyl-5-(3-nitrophenyl)-7-pyridin-3-yl-6,7-dihydropyrazolo[1,5-a]pyrimidine.
| Compound Name | (7S)-3-(4-methoxyphenyl)-2-methyl-5-(3-nitrophenyl)-7-pyridin-3-yl-6,7-dihydropyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 26182717 |
| Molecular Formula | C25H21N5O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (7S)-3-(4-methoxyphenyl)-2-methyl-5-(3-nitrophenyl)-7-pyridin-3-yl-6,7-dihydropyrazolo[1,5-a]pyrimidine |
| SMILES | COc1ccc(-c2c(C)nn3c2N=C(c2cccc([N+](=O)[O-])c2)C[C@H]3c2cccnc2)cc1 |
| InChI | InChI=1S/C25H21N5O3/c1-16-24(17-8-10-21(33-2)11-9-17)25-27-22(18-5-3-7-20(13-18)30(31)32)14-23(29(25)28-16)19-6-4-12-26-15-19/h3-13,15,23H,14H2,1-2H3/t23-/m0/s1 |
| InChIKey | CABZENKRUHPZHD-QHCPKHFHSA-N |
| XLogP | 5.28 |
| TPSA | 95.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|