C14H14N4O3 — CID 2624946
[2-(2-methylanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate (PubChem CID 2624946) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 2624946 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
| SMILES | Cc1ccccc1NC(=O)COC(=O)c1nccnc1N |
| InChI | InChI=1S/C14H14N4O3/c1-9-4-2-3-5-10(9)18-11(19)8-21-14(20)12-13(15)17-7-6-16-12/h2-7H,8H2,1H3,(H2,15,17)(H,18,19) |
| InChIKey | AJXDMSYXEVMMRG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |