C24H23FN4O3 — CID 26340216
5-[(3-fluorophenyl)methyl]-7-[(3-imidazol-1-ylpropylamino)methyl]-[1,3]dioxolo[4,5-g]quinolin-6-one (PubChem CID 26340216) has the molecular formula C24H23FN4O3 and a molecular weight of 434.47 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)methyl]-7-[(3-imidazol-1-ylpropylamino)methyl]-[1,3]dioxolo[4,5-g]quinolin-6-one.
| Compound Name | 5-[(3-fluorophenyl)methyl]-7-[(3-imidazol-1-ylpropylamino)methyl]-[1,3]dioxolo[4,5-g]quinolin-6-one |
|---|---|
| PubChem CID | 26340216 |
| Molecular Formula | C24H23FN4O3 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 5-[(3-fluorophenyl)methyl]-7-[(3-imidazol-1-ylpropylamino)methyl]-[1,3]dioxolo[4,5-g]quinolin-6-one |
| SMILES | O=c1c(CNCCCn2ccnc2)cc2cc3c(cc2n1Cc1cccc(F)c1)OCO3 |
| InChI | InChI=1S/C24H23FN4O3/c25-20-4-1-3-17(9-20)14-29-21-12-23-22(31-16-32-23)11-18(21)10-19(24(29)30)13-26-5-2-7-28-8-6-27-15-28/h1,3-4,6,8-12,15,26H,2,5,7,13-14,16H2 |
| InChIKey | QZYRZPWWKQMREY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|