C16H31N3OS — CID 26536535
1-[(1S,2S)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea (PubChem CID 26536535) has the molecular formula C16H31N3OS and a molecular weight of 313.51 g/mol. Its IUPAC name is 1-[(1S,2S)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(1S,2S)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 26536535 |
| Molecular Formula | C16H31N3OS |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 1-[(1S,2S)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=S)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C16H31N3OS/c1-13-6-4-5-7-14(13)18-15(21)17-12-16(2,3)19-8-10-20-11-9-19/h13-14H,4-12H2,1-3H3,(H2,17,18,21)/t13-,14-/m0/s1 |
| InChIKey | GXZAXMDENYFWGV-KBPBESRZSA-N |
| XLogP | 2.14 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|