C14H18N2OS2 — CID 26598496
[3-(2,3-dimethylphenoxy)propylsulfanyl-methylsulfanylmethylidene]cyanamide (PubChem CID 26598496) has the molecular formula C14H18N2OS2 and a molecular weight of 294.45 g/mol. Its IUPAC name is [3-(2,3-dimethylphenoxy)propylsulfanyl-methylsulfanylmethylidene]cyanamide.
| Compound Name | [3-(2,3-dimethylphenoxy)propylsulfanyl-methylsulfanylmethylidene]cyanamide |
|---|---|
| PubChem CID | 26598496 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | [3-(2,3-dimethylphenoxy)propylsulfanyl-methylsulfanylmethylidene]cyanamide |
| SMILES | CS/C(=N\C#N)SCCCOc1cccc(C)c1C |
| InChI | InChI=1S/C14H18N2OS2/c1-11-6-4-7-13(12(11)2)17-8-5-9-19-14(18-3)16-10-15/h4,6-7H,5,8-9H2,1-3H3/b16-14+ |
| InChIKey | BZORIDONMODNPI-JQIJEIRASA-N |
| XLogP | 4.01 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|