C22H20BrClN2O3 — CID 26760889
(E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(6-chloro-2H-chromen-3-yl)-N-methylprop-2-enamide (PubChem CID 26760889) has the molecular formula C22H20BrClN2O3 and a molecular weight of 475.77 g/mol. Its IUPAC name is (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(6-chloro-2H-chromen-3-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(6-chloro-2H-chromen-3-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 26760889 |
| Molecular Formula | C22H20BrClN2O3 |
| Molecular Weight | 475.77 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | (E)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(6-chloro-2H-chromen-3-yl)-N-methylprop-2-enamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C(=O)/C=C/C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C22H20BrClN2O3/c1-14-9-17(23)4-6-19(14)25-21(27)12-26(2)22(28)8-3-15-10-16-11-18(24)5-7-20(16)29-13-15/h3-11H,12-13H2,1-2H3,(H,25,27)/b8-3+ |
| InChIKey | KJQITMXYKPDKAC-FPYGCLRLSA-N |
| XLogP | 4.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|