About bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+)
bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+) (PubChem CID 26867) has the molecular formula C30H24N2NiO4
and a molecular weight of 535.23 g/mol. Its IUPAC name is bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+).
Molecular Properties
| Compound Name | bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+) |
| PubChem CID | 26867 |
| Molecular Formula | C30H24N2NiO4 |
| Molecular Weight | 535.23 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+) |
| SMILES | CC(=O)N([O-])c1ccc2c(c1)Cc1ccccc1-2.CC(=O)N([O-])c1ccc2c(c1)Cc1ccccc1-2.[Ni+2] |
| InChI | InChI=1S/2C15H12NO2.Ni/c2*1-10(17)16(18)13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15;/h2*2-7,9H,8H2,1H3;/q2*-1;+2 |
| InChIKey | WXUBDSGVWGAHHQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.23 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+)?
The IUPAC name of bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+) (CID 26867) is bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+).
What is the SMILES notation for bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+)?
The canonical SMILES for bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+) is CC(=O)N([O-])c1ccc2c(c1)Cc1ccccc1-2.CC(=O)N([O-])c1ccc2c(c1)Cc1ccccc1-2.[Ni+2].
What is the InChIKey of bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+)?
The InChIKey is WXUBDSGVWGAHHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H12NO2.Ni/c2*1-10(17)16(18)13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15;/h2*2-7,9H,8H2,1H3;/q2*-1;+2.
What are the key properties of bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+)?
bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+) has a molecular weight of 535.23 g/mol, XLogP of 6.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-(9H-fluoren-2-yl)-N-oxidoacetamide);nickel(2+) is sourced from PubChem (CID 26867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).