C19H15NOS2 — CID 27046696
(Z)-1-(4-methylphenyl)-3-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]prop-2-en-1-one (PubChem CID 27046696) has the molecular formula C19H15NOS2 and a molecular weight of 337.47 g/mol. Its IUPAC name is (Z)-1-(4-methylphenyl)-3-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]prop-2-en-1-one.
| Compound Name | (Z)-1-(4-methylphenyl)-3-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 27046696 |
| Molecular Formula | C19H15NOS2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | (Z)-1-(4-methylphenyl)-3-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)/C=C\Sc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C19H15NOS2/c1-14-7-9-16(10-8-14)18(21)11-12-22-19-20-17(13-23-19)15-5-3-2-4-6-15/h2-13H,1H3/b12-11- |
| InChIKey | FOHBRVNEXOJLNC-QXMHVHEDSA-N |
| XLogP | 5.61 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|