C15H20F3N3O5 — CID 27112355
[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-3-carboxylate (PubChem CID 27112355) has the molecular formula C15H20F3N3O5 and a molecular weight of 379.34 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-3-carboxylate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 27112355 |
| Molecular Formula | C15H20F3N3O5 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrole-3-carboxylate |
| SMILES | COCCNC(=O)NC(=O)COC(=O)c1cc(C)n(CC(F)(F)F)c1C |
| InChI | InChI=1S/C15H20F3N3O5/c1-9-6-11(10(2)21(9)8-15(16,17)18)13(23)26-7-12(22)20-14(24)19-4-5-25-3/h6H,4-5,7-8H2,1-3H3,(H2,19,20,22,24) |
| InChIKey | KSDBCJMGDOZJPR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|