C20H16FN3O5S2 — CID 27115896
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate (PubChem CID 27115896) has the molecular formula C20H16FN3O5S2 and a molecular weight of 461.50 g/mol. Its IUPAC name is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate.
| Compound Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate |
|---|---|
| PubChem CID | 27115896 |
| Molecular Formula | C20H16FN3O5S2 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate |
| SMILES | O=C(COC(=O)c1c(-n2cccc2)sc2c1CCSC2)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16FN3O5S2/c21-14-4-3-12(9-15(14)24(27)28)22-17(25)10-29-20(26)18-13-5-8-30-11-16(13)31-19(18)23-6-1-2-7-23/h1-4,6-7,9H,5,8,10-11H2,(H,22,25) |
| InChIKey | HNKVOWHIFIWKNE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|