C23H22N4O5S — CID 27163714
1-(2-cyanophenyl)sulfonyl-N'-(3-methyl-1-benzofuran-2-carbonyl)piperidine-4-carbohydrazide (PubChem CID 27163714) has the molecular formula C23H22N4O5S and a molecular weight of 466.52 g/mol. Its IUPAC name is 1-(2-cyanophenyl)sulfonyl-N'-(3-methyl-1-benzofuran-2-carbonyl)piperidine-4-carbohydrazide.
| Compound Name | 1-(2-cyanophenyl)sulfonyl-N'-(3-methyl-1-benzofuran-2-carbonyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 27163714 |
| Molecular Formula | C23H22N4O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 1-(2-cyanophenyl)sulfonyl-N'-(3-methyl-1-benzofuran-2-carbonyl)piperidine-4-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)C2CCN(S(=O)(=O)c3ccccc3C#N)CC2)oc2ccccc12 |
| InChI | InChI=1S/C23H22N4O5S/c1-15-18-7-3-4-8-19(18)32-21(15)23(29)26-25-22(28)16-10-12-27(13-11-16)33(30,31)20-9-5-2-6-17(20)14-24/h2-9,16H,10-13H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | JBBNNKDGSGCXCK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|