C6H6N8O2 — CID 2718211
N,N'-bis(1,2,4-triazol-4-yl)oxamide (PubChem CID 2718211) has the molecular formula C6H6N8O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is N,N'-bis(1,2,4-triazol-4-yl)oxamide.
| Compound Name | N,N'-bis(1,2,4-triazol-4-yl)oxamide |
|---|---|
| PubChem CID | 2718211 |
| Molecular Formula | C6H6N8O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | N,N'-bis(1,2,4-triazol-4-yl)oxamide |
| SMILES | O=C(Nn1cnnc1)C(=O)Nn1cnnc1 |
| InChI | InChI=1S/C6H6N8O2/c15-5(11-13-1-7-8-2-13)6(16)12-14-3-9-10-4-14/h1-4H,(H,11,15)(H,12,16) |
| InChIKey | GWFWQJALCOUKRR-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|