C6H7FO2 — CID 2725057
(1S,2S)-3-fluorocyclohexa-3,5-diene-1,2-diol (PubChem CID 2725057) has the molecular formula C6H7FO2 and a molecular weight of 130.12 g/mol. Its IUPAC name is (1S,2S)-3-fluorocyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2S)-3-fluorocyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 2725057 |
| Molecular Formula | C6H7FO2 |
| Molecular Weight | 130.12 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | (1S,2S)-3-fluorocyclohexa-3,5-diene-1,2-diol |
| SMILES | O[C@@H]1C(F)=CC=C[C@@H]1O |
| InChI | InChI=1S/C6H7FO2/c7-4-2-1-3-5(8)6(4)9/h1-3,5-6,8-9H/t5-,6+/m0/s1 |
| InChIKey | JSCDWTRUIYAHIC-NTSWFWBYSA-N |
| XLogP | 0.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.12 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |