C14H14ClFN4O2 — CID 2731867
ethyl 3-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-5-methyl-1H-pyrazole-4-carboxylate (PubChem CID 2731867) has the molecular formula C14H14ClFN4O2 and a molecular weight of 324.74 g/mol. Its IUPAC name is ethyl 3-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-5-methyl-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 3-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-5-methyl-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2731867 |
| Molecular Formula | C14H14ClFN4O2 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | ethyl 3-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-5-methyl-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(NN=Cc2c(F)cccc2Cl)n[nH]c1C |
| InChI | InChI=1S/C14H14ClFN4O2/c1-3-22-14(21)12-8(2)18-20-13(12)19-17-7-9-10(15)5-4-6-11(9)16/h4-7H,3H2,1-2H3,(H2,18,19,20) |
| InChIKey | CQUOKKWVVLUJRC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|