C12H13NO4S — CID 2732667
4-(3,5-dimethoxyphenyl)thiomorpholine-3,5-dione (PubChem CID 2732667) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)thiomorpholine-3,5-dione.
| Compound Name | 4-(3,5-dimethoxyphenyl)thiomorpholine-3,5-dione |
|---|---|
| PubChem CID | 2732667 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)thiomorpholine-3,5-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)CSCC2=O)c1 |
| InChI | InChI=1S/C12H13NO4S/c1-16-9-3-8(4-10(5-9)17-2)13-11(14)6-18-7-12(13)15/h3-5H,6-7H2,1-2H3 |
| InChIKey | RCSBMUVJPKFWDB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|