C18H25N3O7S — CID 27377681
1,3-dimethyl-8-(2,3,4-trimethoxyphenyl)sulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 27377681) has the molecular formula C18H25N3O7S and a molecular weight of 427.48 g/mol. Its IUPAC name is 1,3-dimethyl-8-(2,3,4-trimethoxyphenyl)sulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1,3-dimethyl-8-(2,3,4-trimethoxyphenyl)sulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 27377681 |
| Molecular Formula | C18H25N3O7S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1,3-dimethyl-8-(2,3,4-trimethoxyphenyl)sulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1ccc(S(=O)(=O)N2CCC3(CC2)C(=O)N(C)C(=O)N3C)c(OC)c1OC |
| InChI | InChI=1S/C18H25N3O7S/c1-19-16(22)18(20(2)17(19)23)8-10-21(11-9-18)29(24,25)13-7-6-12(26-3)14(27-4)15(13)28-5/h6-7H,8-11H2,1-5H3 |
| InChIKey | XWYODFBORAKVCW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|