C22H23F3N2O7 — CID 27385999
[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 3-ethoxy-4-(2-phenoxyethoxy)benzoate (PubChem CID 27385999) has the molecular formula C22H23F3N2O7 and a molecular weight of 484.43 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 3-ethoxy-4-(2-phenoxyethoxy)benzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 3-ethoxy-4-(2-phenoxyethoxy)benzoate |
|---|---|
| PubChem CID | 27385999 |
| Molecular Formula | C22H23F3N2O7 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 3-ethoxy-4-(2-phenoxyethoxy)benzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)NC(=O)NCC(F)(F)F)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C22H23F3N2O7/c1-2-31-18-12-15(8-9-17(18)33-11-10-32-16-6-4-3-5-7-16)20(29)34-13-19(28)27-21(30)26-14-22(23,24)25/h3-9,12H,2,10-11,13-14H2,1H3,(H2,26,27,28,30) |
| InChIKey | CIAFJRPXVPQFKY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|