C14H7Cl2F3O2S — CID 2744802
S-(2,6-dichlorophenyl) 4-(trifluoromethoxy)benzenecarbothioate (PubChem CID 2744802) has the molecular formula C14H7Cl2F3O2S and a molecular weight of 367.18 g/mol. Its IUPAC name is S-(2,6-dichlorophenyl) 4-(trifluoromethoxy)benzenecarbothioate.
| Compound Name | S-(2,6-dichlorophenyl) 4-(trifluoromethoxy)benzenecarbothioate |
|---|---|
| PubChem CID | 2744802 |
| Molecular Formula | C14H7Cl2F3O2S |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | S-(2,6-dichlorophenyl) 4-(trifluoromethoxy)benzenecarbothioate |
| SMILES | O=C(Sc1c(Cl)cccc1Cl)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H7Cl2F3O2S/c15-10-2-1-3-11(16)12(10)22-13(20)8-4-6-9(7-5-8)21-14(17,18)19/h1-7H |
| InChIKey | HRSHTOSZGGAWFR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|