C21H20Cl2N4O3 — CID 2746222
[[1-amino-3-[4-(4-chlorophenoxy)-3,5-dimethylpyrazol-1-yl]propylidene]amino] 4-chlorobenzoate (PubChem CID 2746222) has the molecular formula C21H20Cl2N4O3 and a molecular weight of 447.32 g/mol. Its IUPAC name is [[1-amino-3-[4-(4-chlorophenoxy)-3,5-dimethylpyrazol-1-yl]propylidene]amino] 4-chlorobenzoate.
| Compound Name | [[1-amino-3-[4-(4-chlorophenoxy)-3,5-dimethylpyrazol-1-yl]propylidene]amino] 4-chlorobenzoate |
|---|---|
| PubChem CID | 2746222 |
| Molecular Formula | C21H20Cl2N4O3 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [[1-amino-3-[4-(4-chlorophenoxy)-3,5-dimethylpyrazol-1-yl]propylidene]amino] 4-chlorobenzoate |
| SMILES | Cc1nn(CCC(N)=NOC(=O)c2ccc(Cl)cc2)c(C)c1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20Cl2N4O3/c1-13-20(29-18-9-7-17(23)8-10-18)14(2)27(25-13)12-11-19(24)26-30-21(28)15-3-5-16(22)6-4-15/h3-10H,11-12H2,1-2H3,(H2,24,26) |
| InChIKey | ZFIBEIBASJXPGN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|