C14H12K2N2O7S2 — CID 2748991
dipotassium;5-amino-2-[2-(4-amino-2-sulfonatophenyl)-2-oxoethyl]benzenesulfonate (PubChem CID 2748991) has the molecular formula C14H12K2N2O7S2 and a molecular weight of 462.59 g/mol. Its IUPAC name is dipotassium;5-amino-2-[2-(4-amino-2-sulfonatophenyl)-2-oxoethyl]benzenesulfonate.
| Compound Name | dipotassium;5-amino-2-[2-(4-amino-2-sulfonatophenyl)-2-oxoethyl]benzenesulfonate |
|---|---|
| PubChem CID | 2748991 |
| Molecular Formula | C14H12K2N2O7S2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 461.94 |
| IUPAC Name | dipotassium;5-amino-2-[2-(4-amino-2-sulfonatophenyl)-2-oxoethyl]benzenesulfonate |
| SMILES | Nc1ccc(CC(=O)c2ccc(N)cc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1.[K+].[K+] |
| InChI | InChI=1S/C14H14N2O7S2.2K/c15-9-2-1-8(13(6-9)24(18,19)20)5-12(17)11-4-3-10(16)7-14(11)25(21,22)23;;/h1-4,6-7H,5,15-16H2,(H,18,19,20)(H,21,22,23);;/q;2*+1/p-2 |
| InChIKey | VTVBFGCAEYBNJQ-UHFFFAOYSA-L |
| XLogP | -5.91 |
| TPSA | 183.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | -5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|