C25H19N5O7S2 — CID 2749997
5-amino-3-[[4-[2-(1H-benzimidazol-2-yl)ethenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 2749997) has the molecular formula C25H19N5O7S2 and a molecular weight of 565.59 g/mol. Its IUPAC name is 5-amino-3-[[4-[2-(1H-benzimidazol-2-yl)ethenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 5-amino-3-[[4-[2-(1H-benzimidazol-2-yl)ethenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 2749997 |
| Molecular Formula | C25H19N5O7S2 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | 5-amino-3-[[4-[2-(1H-benzimidazol-2-yl)ethenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(C=Cc4nc5ccccc5[nH]4)cc3)c(O)c12 |
| InChI | InChI=1S/C25H19N5O7S2/c26-18-13-17(38(32,33)34)11-15-12-21(39(35,36)37)24(25(31)23(15)18)30-29-16-8-5-14(6-9-16)7-10-22-27-19-3-1-2-4-20(19)28-22/h1-13,31H,26H2,(H,27,28)(H,32,33,34)(H,35,36,37)/b10-7?,30-29+ |
| InChIKey | YFCPNBURVWUWDE-UFRFEBDCSA-N |
| XLogP | 5.08 |
| TPSA | 208.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|