C25H18N4O7S2 — CID 2749992
4-[[2-[2-(1H-benzimidazol-2-yl)ethenyl]phenyl]diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 2749992) has the molecular formula C25H18N4O7S2 and a molecular weight of 550.57 g/mol. Its IUPAC name is 4-[[2-[2-(1H-benzimidazol-2-yl)ethenyl]phenyl]diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-[[2-[2-(1H-benzimidazol-2-yl)ethenyl]phenyl]diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 2749992 |
| Molecular Formula | C25H18N4O7S2 |
| Molecular Weight | 550.57 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | 4-[[2-[2-(1H-benzimidazol-2-yl)ethenyl]phenyl]diazenyl]-3-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(/N=N/c3ccccc3C=Cc3nc4ccccc4[nH]3)c(O)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C25H18N4O7S2/c30-25-22(38(34,35)36)14-16-13-17(37(31,32)33)10-11-18(16)24(25)29-28-19-6-2-1-5-15(19)9-12-23-26-20-7-3-4-8-21(20)27-23/h1-14,30H,(H,26,27)(H,31,32,33)(H,34,35,36)/b12-9?,29-28+ |
| InChIKey | DYGFYPFTTUXFLN-VIGVRISJSA-N |
| XLogP | 5.50 |
| TPSA | 182.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|