C22H25N — CID 2751899
2,10-ditert-butyl-14-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(13),2,4(15),5,7,9,11-heptaene (PubChem CID 2751899) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is 2,10-ditert-butyl-14-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(13),2,4(15),5,7,9,11-heptaene.
| Compound Name | 2,10-ditert-butyl-14-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(13),2,4(15),5,7,9,11-heptaene |
|---|---|
| PubChem CID | 2751899 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 2,10-ditert-butyl-14-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(13),2,4(15),5,7,9,11-heptaene |
| SMILES | CC(C)(C)c1cc2cccc3cc(C(C)(C)C)c4ccc1n4c23 |
| InChI | InChI=1S/C22H25N/c1-21(2,3)16-12-14-8-7-9-15-13-17(22(4,5)6)19-11-10-18(16)23(19)20(14)15/h7-13H,1-6H3 |
| InChIKey | HADWNAVBEVHCPA-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |